![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| D10-1_AmI_Testbed_v11_FORTH.pdf | 2024-02-29 15:53 | 3.3M | |
| D10-2_2011-02-28_Integration_and_test_plan_for_BAN_PAN_infrastructure_v1.4_DELTA.pdf | 2024-02-29 15:53 | 897K | |
| D10-3-1 Prototype of backend infrastructure & Integration and test plan for backend infrastructure.pdf | 2024-02-29 15:53 | 1.7M | |
| D10-3-2_Second-prototype-of-backend-infrastructure_V17_FORTHNET.pdf | 2024-02-29 15:53 | 399K | |
| D10-4_2012_03_06_Applications_for_field_trials_V1.pdf | 2024-02-29 15:53 | 6.6M | |
| D10-5 Final prototype of Reaction platform_v10.pdf | 2024-02-29 15:53 | 5.0M | |
| ID10-4-1_2011-03-15_Manuals_and_deployment_plans_for_the_in-hospital_field_trial_v1.1_FORTH.pdf | 2024-02-29 15:53 | 3.3M | |
| ID10-4-2_Manuals_and_deployment_plans_for_the_primary_care_field_trial_V33_FORTH.pdf | 2024-02-29 15:53 | 2.3M | |