![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ACGT_WP1_Presentation_review_april07_MGT STRUCTURE.draft.ppt | 2024-02-29 15:53 | 1.0M | |
| 20070423_ACGT_Review_WP11_final.ppt | 2024-02-29 15:53 | 1.8M | |
| ACGT_WP10_IRI_short_v02.ppt | 2024-02-29 15:53 | 478K | |
| ACGT_WP10_IRI_v04=final.ppt | 2024-02-29 15:53 | 1.2M | |
| ACGT WP13 Poznan2007 2 slides.ppt | 2024-02-29 15:53 | 480K | |
| Final WP & Project Progress Presentations/ | 2024-02-29 15:53 | - | |
| WP1 RR Slides/ | 2024-02-29 15:53 | - | |
| ACGT WP2 UdS Review_Poznan_final.ppt | 2024-02-29 15:53 | 685K | |
| WP8 1ST YEAR SHORT REPORT (1ST FORMAL REVIEW).ppt | 2024-02-29 15:53 | 1.2M | |
| Presentations for the Demonstrators/ | 2024-02-29 15:53 | - | |
| ACGT Review report april 2007.pdf | 2024-02-29 15:53 | 18M | |
| ACGT_WP7_UPM_Presentation_review07.ppt | 2024-02-29 15:53 | 1.0M | |
| ACGT WP13 E and V Poznan Apr2007 1_1.ppt | 2024-02-29 15:53 | 1.8M | |
| ACGT_Review_2007_WP6.ppt | 2024-02-29 15:53 | 1.0M | |
| ACGT_WP15_POZNAN_1ST_REVIEW_HG_v1.0.ppt | 2024-02-29 15:53 | 4.2M | |
| ACGT WP16 PPT for Review 1.ppt | 2024-02-29 15:53 | 1.0M | |